Molecule Detail Page
Molecule name
Additional molecule names
|
Molecular Structure |
Properties calculated from structure
| Property | Value | |
|---|---|---|
| Formula | C40H56 | |
| Weight | 536.873 [g/mol] | |
| Complexity | 1116.38 | |
| XLogP | 10.10 | |
| TPSA | 0.00 | |
| #HDonors | 0 | |
| #HAcceptors | 0 | |
| Gibbs Energy | 278.6 [kcal/mol] | |
| 1H NMR spectrum | Predict NMR spectrum | |
| Isotopic distribution | Predict Isotopic distribution |
Structure representations/Cross-references
| Property | Value | |
|---|---|---|
| SMILES | CC1(C)CCCC(C)=C1/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C2=C(C)CCCC2(C)C | |
| InChI | InChI=1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-22,25-28H,15-16,23-24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+ | |
| InChI-Key | InChIKey=OENHQHLEOONYIE-JLTXGRSLSA-N | |
| KEGG ID | C02094 | |
| ChEBI ID | CHEBI:17579 | |
| PubChem-CID | 5280489 |
Taxonomy
4 taxonomy entriesMost similar molecules
18 molecules (tanimoto >90%)
| Molecule name | Image | Tanimoto |
|---|---|---|
| 3,4-Didehydro-beta-carotene |
|
100.0% |
| 7,8-Dihydro-beta-carotene |
|
100.0% |
| Isocarotene |
|
100.0% |
| alpha-Carotene |
|
100.0% |
| beta,gamma-Carotene |
|
98.0% |
| (S,S)-epsilon-Carotene |
|
97.9% |
| 3,4-Didehydro-alpha-carotene |
|
97.9% |
| 7,7-prime-Dihydro-beta-carotene |
|
97.9% |
| Tetrahydro-beta-carotene |
|
97.9% |
| epsilon-Carotene |
|
97.9% |
| beta-Isorenieratene |
|
96.0% |
| gamma,gamma-Carotene |
|
95.9% |
| Sarcinene |
|
95.8% |
| Tethyanine |
|
92.0% |
| Tethyatene |
|
92.0% |
| Anhydroeschscholtzxanthin |
|
91.7% |
| Tetradehydro-beta-carotene |
|
91.7% |
| 3,4-Dehydro-gamma,chi-carotene |
|
90.2% |
Reactions the molecule is involved in
40 reactionsPathways the molecule is involved in
6 pathways| Reactions of Carotene |
| Metabolism of Terpens, Carotenoids, and Retinoids |
| Special network of Carotenoids (1104 rxns) |
| Biosynthesis of Carotene |
| Biosynthesis of Retinol |
| Reactions of Retinol |
References
| http://sun.ars-grin.gov:8080/npgspub/xsql/duke/plantdisp.xsql?taxon=878 |





